C19H25ClN2O2 — CID 171572637
4-[[[2-chloro-5-[2-(2-methyloxolan-3-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol (PubChem CID 171572637) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is 4-[[[2-chloro-5-[2-(2-methyloxolan-3-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[[2-chloro-5-[2-(2-methyloxolan-3-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 171572637 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-[[[2-chloro-5-[2-(2-methyloxolan-3-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol |
| SMILES | CC1OCCC1C#Cc1cnc(Cl)cc1NCC1CCC(O)CC1 |
| InChI | InChI=1S/C19H25ClN2O2/c1-13-15(8-9-24-13)4-5-16-12-22-19(20)10-18(16)21-11-14-2-6-17(23)7-3-14/h10,12-15,17,23H,2-3,6-9,11H2,1H3,(H,21,22) |
| InChIKey | PGSTZKBWHZAGHW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|