C18H27ClIN3O2 — CID 167425709
[4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]cyclohexyl]methyl N-tert-butylcarbamate (PubChem CID 167425709) has the molecular formula C18H27ClIN3O2 and a molecular weight of 479.79 g/mol. Its IUPAC name is [4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]cyclohexyl]methyl N-tert-butylcarbamate.
| Compound Name | [4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]cyclohexyl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 167425709 |
| Molecular Formula | C18H27ClIN3O2 |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | [4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]cyclohexyl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC1CCC(CNc2cc(Cl)ncc2I)CC1 |
| InChI | InChI=1S/C18H27ClIN3O2/c1-18(2,3)23-17(24)25-11-13-6-4-12(5-7-13)9-21-15-8-16(19)22-10-14(15)20/h8,10,12-13H,4-7,9,11H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | FIYTYPBEVAZDPD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|