C22H27ClFN3O — CID 167425467
[6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-3-pyridinyl]-(4-fluorophenyl)methanone (PubChem CID 167425467) has the molecular formula C22H27ClFN3O and a molecular weight of 403.93 g/mol. Its IUPAC name is [6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-3-pyridinyl]-(4-fluorophenyl)methanone.
| Compound Name | [6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-3-pyridinyl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 167425467 |
| Molecular Formula | C22H27ClFN3O |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-3-pyridinyl]-(4-fluorophenyl)methanone |
| SMILES | CN(C)CC1CCC(CNc2cc(Cl)ncc2C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H27ClFN3O/c1-27(2)14-16-5-3-15(4-6-16)12-25-20-11-21(23)26-13-19(20)22(28)17-7-9-18(24)10-8-17/h7-11,13,15-16H,3-6,12,14H2,1-2H3,(H,25,26) |
| InChIKey | TWUPGYPXGPHPQO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|