C18H28ClFN4O — CID 167425441
6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-N-(2-fluoroethyl)pyridine-3-carboxamide (PubChem CID 167425441) has the molecular formula C18H28ClFN4O and a molecular weight of 370.90 g/mol. Its IUPAC name is 6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-N-(2-fluoroethyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-N-(2-fluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167425441 |
| Molecular Formula | C18H28ClFN4O |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]methylamino]-N-(2-fluoroethyl)pyridine-3-carboxamide |
| SMILES | CN(C)CC1CCC(CNc2cc(Cl)ncc2C(=O)NCCF)CC1 |
| InChI | InChI=1S/C18H28ClFN4O/c1-24(2)12-14-5-3-13(4-6-14)10-22-16-9-17(19)23-11-15(16)18(25)21-8-7-20/h9,11,13-14H,3-8,10,12H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | QOSPSFNPUNGXBW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|