C22H28N6O2 — CID 160598582
4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 160598582) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 160598582 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | C#Cc1cnc(Nc2cc(NCC3CCCCC3)c(C(=O)NCCOC)cn2)cn1 |
| InChI | InChI=1S/C22H28N6O2/c1-3-17-13-26-21(15-24-17)28-20-11-19(25-12-16-7-5-4-6-8-16)18(14-27-20)22(29)23-9-10-30-2/h1,11,13-16H,4-10,12H2,2H3,(H,23,29)(H2,25,26,27,28) |
| InChIKey | MSGRXLBTNCRIJX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|