C17H21N7 — CID 88882255
2-N-(5-ethynylpyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine (PubChem CID 88882255) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-N-(5-ethynylpyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine.
| Compound Name | 2-N-(5-ethynylpyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine |
|---|---|
| PubChem CID | 88882255 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 2-N-(5-ethynylpyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine |
| SMILES | C#Cc1cnc(Nc2cc(NCC3CCCCN3)c(N)cn2)cn1 |
| InChI | InChI=1S/C17H21N7/c1-2-12-8-22-17(11-20-12)24-16-7-15(14(18)10-23-16)21-9-13-5-3-4-6-19-13/h1,7-8,10-11,13,19H,3-6,9,18H2,(H2,21,22,23,24) |
| InChIKey | UFVVSWJWRVMCQW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|