C24H26N6O2 — CID 88882320
2-N-(5-ethynylpyrazin-2-yl)-5-[4-(methoxymethyl)phenyl]-4-N-[[(2R)-morpholin-2-yl]methyl]pyridine-2,4-diamine (PubChem CID 88882320) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-N-(5-ethynylpyrazin-2-yl)-5-[4-(methoxymethyl)phenyl]-4-N-[[(2R)-morpholin-2-yl]methyl]pyridine-2,4-diamine.
| Compound Name | 2-N-(5-ethynylpyrazin-2-yl)-5-[4-(methoxymethyl)phenyl]-4-N-[[(2R)-morpholin-2-yl]methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 88882320 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-N-(5-ethynylpyrazin-2-yl)-5-[4-(methoxymethyl)phenyl]-4-N-[[(2R)-morpholin-2-yl]methyl]pyridine-2,4-diamine |
| SMILES | C#Cc1cnc(Nc2cc(NC[C@H]3CNCCO3)c(-c3ccc(COC)cc3)cn2)cn1 |
| InChI | InChI=1S/C24H26N6O2/c1-3-19-11-28-24(15-26-19)30-23-10-22(27-13-20-12-25-8-9-32-20)21(14-29-23)18-6-4-17(5-7-18)16-31-2/h1,4-7,10-11,14-15,20,25H,8-9,12-13,16H2,2H3,(H2,27,28,29,30)/t20-/m1/s1 |
| InChIKey | FZIIXDAUGVGYGU-HXUWFJFHSA-N |
| XLogP | 2.81 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|