C15H18N8O — CID 155594587
5-[[6-methyl-5-(morpholin-2-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile (PubChem CID 155594587) has the molecular formula C15H18N8O and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-[[6-methyl-5-(morpholin-2-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[6-methyl-5-(morpholin-2-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 155594587 |
| Molecular Formula | C15H18N8O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 5-[[6-methyl-5-(morpholin-2-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
| SMILES | Cc1nnc(Nc2cnc(C#N)cn2)cc1NCC1CNCCO1 |
| InChI | InChI=1S/C15H18N8O/c1-10-13(19-8-12-7-17-2-3-24-12)4-14(23-22-10)21-15-9-18-11(5-16)6-20-15/h4,6,9,12,17H,2-3,7-8H2,1H3,(H2,19,20,21,23) |
| InChIKey | CJSUNOXAHAOVIJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |