C15H15N9O — CID 164942061
5-[[6-isocyano-5-[[(2S)-morpholin-2-yl]methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile (PubChem CID 164942061) has the molecular formula C15H15N9O and a molecular weight of 337.35 g/mol. Its IUPAC name is 5-[[6-isocyano-5-[[(2S)-morpholin-2-yl]methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[6-isocyano-5-[[(2S)-morpholin-2-yl]methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 164942061 |
| Molecular Formula | C15H15N9O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 5-[[6-isocyano-5-[[(2S)-morpholin-2-yl]methylamino]pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
| SMILES | [C-]#[N+]c1nnc(Nc2cnc(C#N)cn2)cc1NC[C@@H]1CNCCO1 |
| InChI | InChI=1S/C15H15N9O/c1-17-15-12(20-8-11-7-18-2-3-25-11)4-13(23-24-15)22-14-9-19-10(5-16)6-21-14/h4,6,9,11,18H,2-3,7-8H2,(H2,20,21,22,23)/t11-/m0/s1 |
| InChIKey | PNUJNMLXNOBBCM-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|