C15H17N7O2 — CID 167562474
5-[[6-methyl-5-[[(2S)-morpholin-2-yl]methoxy]pyridazin-3-yl]amino]pyrazine-2-carbonitrile (PubChem CID 167562474) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 5-[[6-methyl-5-[[(2S)-morpholin-2-yl]methoxy]pyridazin-3-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[6-methyl-5-[[(2S)-morpholin-2-yl]methoxy]pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 167562474 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-[[6-methyl-5-[[(2S)-morpholin-2-yl]methoxy]pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
| SMILES | Cc1nnc(Nc2cnc(C#N)cn2)cc1OC[C@@H]1CNCCO1 |
| InChI | InChI=1S/C15H17N7O2/c1-10-13(24-9-12-7-17-2-3-23-12)4-14(22-21-10)20-15-8-18-11(5-16)6-19-15/h4,6,8,12,17H,2-3,7,9H2,1H3,(H,19,20,22)/t12-/m0/s1 |
| InChIKey | DVNXBPOTSUHSNP-LBPRGKRZSA-N |
| XLogP | 0.56 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |