C18H23N7O3 — CID 88578049
5-[[5-(methylperoxymethyl)-4-[2-[(2S)-morpholin-2-yl]ethylamino]-2-pyridinyl]amino]pyrazine-2-carbonitrile (PubChem CID 88578049) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 5-[[5-(methylperoxymethyl)-4-[2-[(2S)-morpholin-2-yl]ethylamino]-2-pyridinyl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[5-(methylperoxymethyl)-4-[2-[(2S)-morpholin-2-yl]ethylamino]-2-pyridinyl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 88578049 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 5-[[5-(methylperoxymethyl)-4-[2-[(2S)-morpholin-2-yl]ethylamino]-2-pyridinyl]amino]pyrazine-2-carbonitrile |
| SMILES | COOCc1cnc(Nc2cnc(C#N)cn2)cc1NCC[C@H]1CNCCO1 |
| InChI | InChI=1S/C18H23N7O3/c1-26-28-12-13-8-23-17(25-18-11-22-14(7-19)9-24-18)6-16(13)21-3-2-15-10-20-4-5-27-15/h6,8-9,11,15,20H,2-5,10,12H2,1H3,(H2,21,23,24,25)/t15-/m0/s1 |
| InChIKey | TZEHWEHDVMIJDH-HNNXBMFYSA-N |
| XLogP | 1.36 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|