C22H21FN6O — CID 88882317
2-N-(5-ethynylpyrazin-2-yl)-5-(4-fluorophenyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine (PubChem CID 88882317) has the molecular formula C22H21FN6O and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-N-(5-ethynylpyrazin-2-yl)-5-(4-fluorophenyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine.
| Compound Name | 2-N-(5-ethynylpyrazin-2-yl)-5-(4-fluorophenyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 88882317 |
| Molecular Formula | C22H21FN6O |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-N-(5-ethynylpyrazin-2-yl)-5-(4-fluorophenyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine |
| SMILES | C#Cc1cnc(Nc2cc(NC[C@@H]3CNCCO3)c(-c3ccc(F)cc3)cn2)cn1 |
| InChI | InChI=1S/C22H21FN6O/c1-2-17-10-27-22(14-25-17)29-21-9-20(26-12-18-11-24-7-8-30-18)19(13-28-21)15-3-5-16(23)6-4-15/h1,3-6,9-10,13-14,18,24H,7-8,11-12H2,(H2,26,27,28,29)/t18-/m0/s1 |
| InChIKey | WJMZBGOUEBAKQN-SFHVURJKSA-N |
| XLogP | 2.80 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|