C20H22N6O2 — CID 88882323
2-N-(5-ethynylpyrazin-2-yl)-5-(3-methoxyprop-1-ynyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine (PubChem CID 88882323) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-N-(5-ethynylpyrazin-2-yl)-5-(3-methoxyprop-1-ynyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine.
| Compound Name | 2-N-(5-ethynylpyrazin-2-yl)-5-(3-methoxyprop-1-ynyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 88882323 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-N-(5-ethynylpyrazin-2-yl)-5-(3-methoxyprop-1-ynyl)-4-N-[[(2S)-morpholin-2-yl]methyl]pyridine-2,4-diamine |
| SMILES | C#Cc1cnc(Nc2cc(NC[C@@H]3CNCCO3)c(C#CCOC)cn2)cn1 |
| InChI | InChI=1S/C20H22N6O2/c1-3-16-11-25-20(14-22-16)26-19-9-18(15(10-24-19)5-4-7-27-2)23-13-17-12-21-6-8-28-17/h1,9-11,14,17,21H,6-8,12-13H2,2H3,(H2,23,24,25,26)/t17-/m0/s1 |
| InChIKey | VHDKTZOIHITCMZ-KRWDZBQOSA-N |
| XLogP | 0.99 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|