C20H23N5O2 — CID 159692284
methyl 4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]pyridine-3-carboxylate (PubChem CID 159692284) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is methyl 4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]pyridine-3-carboxylate.
| Compound Name | methyl 4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 159692284 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | methyl 4-(cyclohexylmethylamino)-6-[(5-ethynylpyrazin-2-yl)amino]pyridine-3-carboxylate |
| SMILES | C#Cc1cnc(Nc2cc(NCC3CCCCC3)c(C(=O)OC)cn2)cn1 |
| InChI | InChI=1S/C20H23N5O2/c1-3-15-11-23-19(13-21-15)25-18-9-17(16(12-24-18)20(26)27-2)22-10-14-7-5-4-6-8-14/h1,9,11-14H,4-8,10H2,2H3,(H2,22,23,24,25) |
| InChIKey | YPPBWFOBKANNBW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|