C18H22N8O — CID 42610172
N-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)-3-pyridinyl]acetamide (PubChem CID 42610172) has the molecular formula C18H22N8O and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)-3-pyridinyl]acetamide.
| Compound Name | N-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 42610172 |
| Molecular Formula | C18H22N8O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[6-[(5-cyanopyrazin-2-yl)amino]-4-(piperidin-4-ylmethylamino)-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cnc(Nc2cnc(C#N)cn2)cc1NCC1CCNCC1 |
| InChI | InChI=1S/C18H22N8O/c1-12(27)25-16-10-24-17(26-18-11-21-14(7-19)9-23-18)6-15(16)22-8-13-2-4-20-5-3-13/h6,9-11,13,20H,2-5,8H2,1H3,(H,25,27)(H2,22,23,24,26) |
| InChIKey | PUWXRWRIEGIWQC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |