C22H23N7S — CID 70669554
5-[[4-(piperidin-4-ylmethylamino)-5-(3-sulfanylphenyl)-2-pyridinyl]amino]pyrazine-2-carbonitrile (PubChem CID 70669554) has the molecular formula C22H23N7S and a molecular weight of 417.54 g/mol. Its IUPAC name is 5-[[4-(piperidin-4-ylmethylamino)-5-(3-sulfanylphenyl)-2-pyridinyl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[4-(piperidin-4-ylmethylamino)-5-(3-sulfanylphenyl)-2-pyridinyl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 70669554 |
| Molecular Formula | C22H23N7S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 5-[[4-(piperidin-4-ylmethylamino)-5-(3-sulfanylphenyl)-2-pyridinyl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2cc(NCC3CCNCC3)c(-c3cccc(S)c3)cn2)cn1 |
| InChI | InChI=1S/C22H23N7S/c23-10-17-12-27-22(14-25-17)29-21-9-20(26-11-15-4-6-24-7-5-15)19(13-28-21)16-2-1-3-18(30)8-16/h1-3,8-9,12-15,24,30H,4-7,11H2,(H2,26,27,28,29) |
| InChIKey | OOOMERRSVVNEPK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|