C15H17BrN8 — CID 155595069
5-[[6-bromo-5-(piperidin-4-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile (PubChem CID 155595069) has the molecular formula C15H17BrN8 and a molecular weight of 389.26 g/mol. Its IUPAC name is 5-[[6-bromo-5-(piperidin-4-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[6-bromo-5-(piperidin-4-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 155595069 |
| Molecular Formula | C15H17BrN8 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 5-[[6-bromo-5-(piperidin-4-ylmethylamino)pyridazin-3-yl]amino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(Nc2cc(NCC3CCNCC3)c(Br)nn2)cn1 |
| InChI | InChI=1S/C15H17BrN8/c16-15-12(20-7-10-1-3-18-4-2-10)5-13(23-24-15)22-14-9-19-11(6-17)8-21-14/h5,8-10,18H,1-4,7H2,(H2,20,21,22,23) |
| InChIKey | ONHCJOYWVHDXES-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |