C16H20N8 — CID 59613521
2-N-(5-isocyanopyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine (PubChem CID 59613521) has the molecular formula C16H20N8 and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-N-(5-isocyanopyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine.
| Compound Name | 2-N-(5-isocyanopyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine |
|---|---|
| PubChem CID | 59613521 |
| Molecular Formula | C16H20N8 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-N-(5-isocyanopyrazin-2-yl)-4-N-(piperidin-2-ylmethyl)pyridine-2,4,5-triamine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(NCC3CCCCN3)c(N)cn2)cn1 |
| InChI | InChI=1S/C16H20N8/c1-18-15-9-23-16(10-22-15)24-14-6-13(12(17)8-21-14)20-7-11-4-2-3-5-19-11/h6,8-11,19H,2-5,7,17H2,(H2,20,21,23,24) |
| InChIKey | FXGIIDYKTZOEBJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|