C12H15F3N2 — CID 106632842
2,3,4-trifluoro-N-(piperidin-2-ylmethyl)aniline (PubChem CID 106632842) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(piperidin-2-ylmethyl)aniline.
| Compound Name | 2,3,4-trifluoro-N-(piperidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 106632842 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2,3,4-trifluoro-N-(piperidin-2-ylmethyl)aniline |
| SMILES | Fc1ccc(NCC2CCCCN2)c(F)c1F |
| InChI | InChI=1S/C12H15F3N2/c13-9-4-5-10(12(15)11(9)14)17-7-8-3-1-2-6-16-8/h4-5,8,16-17H,1-3,6-7H2 |
| InChIKey | PHBCKXGOWMIMPZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|