C11H12F4N2 — CID 107643785
2,3,5,6-tetrafluoro-N-(pyrrolidin-2-ylmethyl)aniline (PubChem CID 107643785) has the molecular formula C11H12F4N2 and a molecular weight of 248.22 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(pyrrolidin-2-ylmethyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-(pyrrolidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 107643785 |
| Molecular Formula | C11H12F4N2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(pyrrolidin-2-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(F)c(NCC2CCCN2)c1F |
| InChI | InChI=1S/C11H12F4N2/c12-7-4-8(13)10(15)11(9(7)14)17-5-6-2-1-3-16-6/h4,6,16-17H,1-3,5H2 |
| InChIKey | PCLCGYIWKRWEDH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|