C12H13F4NO — CID 103289558
2-[(2,3,5,6-tetrafluorophenoxy)methyl]piperidine (PubChem CID 103289558) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 2-[(2,3,5,6-tetrafluorophenoxy)methyl]piperidine.
| Compound Name | 2-[(2,3,5,6-tetrafluorophenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 103289558 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-[(2,3,5,6-tetrafluorophenoxy)methyl]piperidine |
| SMILES | Fc1cc(F)c(F)c(OCC2CCCCN2)c1F |
| InChI | InChI=1S/C12H13F4NO/c13-8-5-9(14)11(16)12(10(8)15)18-6-7-3-1-2-4-17-7/h5,7,17H,1-4,6H2 |
| InChIKey | MGMGXIGYPCILOH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|