C15H24N2 — CID 115208055
2,3,5,6-tetramethyl-N-(pyrrolidin-2-ylmethyl)aniline (PubChem CID 115208055) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-(pyrrolidin-2-ylmethyl)aniline.
| Compound Name | 2,3,5,6-tetramethyl-N-(pyrrolidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 115208055 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-(pyrrolidin-2-ylmethyl)aniline |
| SMILES | Cc1cc(C)c(C)c(NCC2CCCN2)c1C |
| InChI | InChI=1S/C15H24N2/c1-10-8-11(2)13(4)15(12(10)3)17-9-14-6-5-7-16-14/h8,14,16-17H,5-7,9H2,1-4H3 |
| InChIKey | DDOHRMAVGPULQC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |