C13H20N2O — CID 106637684
2,6-dimethyl-3-(pyrrolidin-2-ylmethylamino)phenol (PubChem CID 106637684) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2,6-dimethyl-3-(pyrrolidin-2-ylmethylamino)phenol.
| Compound Name | 2,6-dimethyl-3-(pyrrolidin-2-ylmethylamino)phenol |
|---|---|
| PubChem CID | 106637684 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2,6-dimethyl-3-(pyrrolidin-2-ylmethylamino)phenol |
| SMILES | Cc1ccc(NCC2CCCN2)c(C)c1O |
| InChI | InChI=1S/C13H20N2O/c1-9-5-6-12(10(2)13(9)16)15-8-11-4-3-7-14-11/h5-6,11,14-16H,3-4,7-8H2,1-2H3 |
| InChIKey | YKDJCDNWSWYZIX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |