C13H18F2N2O — CID 115047766
5-(1,1-difluoroethyl)-2-(pyrrolidin-2-ylmethylamino)phenol (PubChem CID 115047766) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2-(pyrrolidin-2-ylmethylamino)phenol.
| Compound Name | 5-(1,1-difluoroethyl)-2-(pyrrolidin-2-ylmethylamino)phenol |
|---|---|
| PubChem CID | 115047766 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2-(pyrrolidin-2-ylmethylamino)phenol |
| SMILES | CC(F)(F)c1ccc(NCC2CCCN2)c(O)c1 |
| InChI | InChI=1S/C13H18F2N2O/c1-13(14,15)9-4-5-11(12(18)7-9)17-8-10-3-2-6-16-10/h4-5,7,10,16-18H,2-3,6,8H2,1H3 |
| InChIKey | QFCLVMNYBPSIDD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|