C13H15F5N2 — CID 115053274
4-(difluoromethyl)-N-(pyrrolidin-2-ylmethyl)-2-(trifluoromethyl)aniline (PubChem CID 115053274) has the molecular formula C13H15F5N2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-(difluoromethyl)-N-(pyrrolidin-2-ylmethyl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-(difluoromethyl)-N-(pyrrolidin-2-ylmethyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 115053274 |
| Molecular Formula | C13H15F5N2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-(difluoromethyl)-N-(pyrrolidin-2-ylmethyl)-2-(trifluoromethyl)aniline |
| SMILES | FC(F)c1ccc(NCC2CCCN2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F5N2/c14-12(15)8-3-4-11(10(6-8)13(16,17)18)20-7-9-2-1-5-19-9/h3-4,6,9,12,19-20H,1-2,5,7H2 |
| InChIKey | SVHWPSZTTDGWSV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |