C17H24F3N — CID 53404787
N-(cyclohexylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline (PubChem CID 53404787) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline.
| Compound Name | N-(cyclohexylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 53404787 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N-(cyclohexylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline |
| SMILES | CC(C)c1ccc(NCC2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3N/c1-12(2)14-8-9-16(15(10-14)17(18,19)20)21-11-13-6-4-3-5-7-13/h8-10,12-13,21H,3-7,11H2,1-2H3 |
| InChIKey | MYFHVRXICLJQDG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |