C13H19FN2 — CID 43371532
1-N-(cyclohexylmethyl)-4-fluorobenzene-1,2-diamine (PubChem CID 43371532) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-N-(cyclohexylmethyl)-4-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-(cyclohexylmethyl)-4-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 43371532 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-N-(cyclohexylmethyl)-4-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)ccc1NCC1CCCCC1 |
| InChI | InChI=1S/C13H19FN2/c14-11-6-7-13(12(15)8-11)16-9-10-4-2-1-3-5-10/h6-8,10,16H,1-5,9,15H2 |
| InChIKey | AMOCQGAQFFEDIP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|