C13H19IN2 — CID 66066462
1-N-(cyclohexylmethyl)-4-iodobenzene-1,2-diamine (PubChem CID 66066462) has the molecular formula C13H19IN2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-N-(cyclohexylmethyl)-4-iodobenzene-1,2-diamine.
| Compound Name | 1-N-(cyclohexylmethyl)-4-iodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66066462 |
| Molecular Formula | C13H19IN2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-N-(cyclohexylmethyl)-4-iodobenzene-1,2-diamine |
| SMILES | Nc1cc(I)ccc1NCC1CCCCC1 |
| InChI | InChI=1S/C13H19IN2/c14-11-6-7-13(12(15)8-11)16-9-10-4-2-1-3-5-10/h6-8,10,16H,1-5,9,15H2 |
| InChIKey | DWHDOGCYUWBONF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|