C15H15FN2 — CID 66396180
1-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-fluorobenzene-1,2-diamine (PubChem CID 66396180) has the molecular formula C15H15FN2 and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66396180 |
| Molecular Formula | C15H15FN2 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-4-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)ccc1NCC1Cc2ccccc21 |
| InChI | InChI=1S/C15H15FN2/c16-12-5-6-15(14(17)8-12)18-9-11-7-10-3-1-2-4-13(10)11/h1-6,8,11,18H,7,9,17H2 |
| InChIKey | VYXOHMBIRMLCPG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|