C15H12BrF2N — CID 102853360
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-bromo-2,4-difluoroaniline (PubChem CID 102853360) has the molecular formula C15H12BrF2N and a molecular weight of 324.17 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-bromo-2,4-difluoroaniline.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-bromo-2,4-difluoroaniline |
|---|---|
| PubChem CID | 102853360 |
| Molecular Formula | C15H12BrF2N |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-5-bromo-2,4-difluoroaniline |
| SMILES | Fc1cc(F)c(NCC2Cc3ccccc32)cc1Br |
| InChI | InChI=1S/C15H12BrF2N/c16-12-6-15(14(18)7-13(12)17)19-8-10-5-9-3-1-2-4-11(9)10/h1-4,6-7,10,19H,5,8H2 |
| InChIKey | PTIDMNKPVUTGMG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|