C14H22FN3 — CID 115124856
4-fluoro-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine (PubChem CID 115124856) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-fluoro-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115124856 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 4-fluoro-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine |
| SMILES | CN1CCCC(CCNc2ccc(F)cc2N)C1 |
| InChI | InChI=1S/C14H22FN3/c1-18-8-2-3-11(10-18)6-7-17-14-5-4-12(15)9-13(14)16/h4-5,9,11,17H,2-3,6-8,10,16H2,1H3 |
| InChIKey | WOPPMYFETJTKFT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|