C18H26F3N — CID 53404785
N-(cycloheptylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline (PubChem CID 53404785) has the molecular formula C18H26F3N and a molecular weight of 313.41 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline.
| Compound Name | N-(cycloheptylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 53404785 |
| Molecular Formula | C18H26F3N |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-(cycloheptylmethyl)-4-propan-2-yl-2-(trifluoromethyl)aniline |
| SMILES | CC(C)c1ccc(NCC2CCCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H26F3N/c1-13(2)15-9-10-17(16(11-15)18(19,20)21)22-12-14-7-5-3-4-6-8-14/h9-11,13-14,22H,3-8,12H2,1-2H3 |
| InChIKey | JXENAECBHABSMR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |