C15H20F4N2 — CID 115053481
4-(1-fluoroethyl)-N-(piperidin-2-ylmethyl)-2-(trifluoromethyl)aniline (PubChem CID 115053481) has the molecular formula C15H20F4N2 and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-N-(piperidin-2-ylmethyl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-(1-fluoroethyl)-N-(piperidin-2-ylmethyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 115053481 |
| Molecular Formula | C15H20F4N2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-(1-fluoroethyl)-N-(piperidin-2-ylmethyl)-2-(trifluoromethyl)aniline |
| SMILES | CC(F)c1ccc(NCC2CCCCN2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F4N2/c1-10(16)11-5-6-14(13(8-11)15(17,18)19)21-9-12-4-2-3-7-20-12/h5-6,8,10,12,20-21H,2-4,7,9H2,1H3 |
| InChIKey | LRBCIWPDRWSINJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |