C14H18BrF3N2 — CID 79541571
4-bromo-N-(1-pyrrolidin-2-ylpropan-2-yl)-2-(trifluoromethyl)aniline (PubChem CID 79541571) has the molecular formula C14H18BrF3N2 and a molecular weight of 351.21 g/mol. Its IUPAC name is 4-bromo-N-(1-pyrrolidin-2-ylpropan-2-yl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-N-(1-pyrrolidin-2-ylpropan-2-yl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 79541571 |
| Molecular Formula | C14H18BrF3N2 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 4-bromo-N-(1-pyrrolidin-2-ylpropan-2-yl)-2-(trifluoromethyl)aniline |
| SMILES | CC(CC1CCCN1)Nc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18BrF3N2/c1-9(7-11-3-2-6-19-11)20-13-5-4-10(15)8-12(13)14(16,17)18/h4-5,8-9,11,19-20H,2-3,6-7H2,1H3 |
| InChIKey | DISSDRMYNOKGQA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |