C13H17Br3N2 — CID 79541024
2,4,6-tribromo-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline (PubChem CID 79541024) has the molecular formula C13H17Br3N2 and a molecular weight of 441.01 g/mol. Its IUPAC name is 2,4,6-tribromo-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline.
| Compound Name | 2,4,6-tribromo-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 79541024 |
| Molecular Formula | C13H17Br3N2 |
| Molecular Weight | 441.01 g/mol |
| Exact Mass | 437.89 |
| IUPAC Name | 2,4,6-tribromo-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline |
| SMILES | CC(CC1CCCN1)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H17Br3N2/c1-8(5-10-3-2-4-17-10)18-13-11(15)6-9(14)7-12(13)16/h6-8,10,17-18H,2-5H2,1H3 |
| InChIKey | NYNIFQTVFLNBBA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.01 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |