C14H20Br2N2 — CID 79540891
2,6-dibromo-4-methyl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline (PubChem CID 79540891) has the molecular formula C14H20Br2N2 and a molecular weight of 376.14 g/mol. Its IUPAC name is 2,6-dibromo-4-methyl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline.
| Compound Name | 2,6-dibromo-4-methyl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 79540891 |
| Molecular Formula | C14H20Br2N2 |
| Molecular Weight | 376.14 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 2,6-dibromo-4-methyl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline |
| SMILES | Cc1cc(Br)c(NC(C)CC2CCCN2)c(Br)c1 |
| InChI | InChI=1S/C14H20Br2N2/c1-9-6-12(15)14(13(16)7-9)18-10(2)8-11-4-3-5-17-11/h6-7,10-11,17-18H,3-5,8H2,1-2H3 |
| InChIKey | PLYQRQCDZKPKTE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |