C13H18N2O2 — CID 61179515
(2S)-N-(3-hydroxy-2,4-dimethylphenyl)pyrrolidine-2-carboxamide (PubChem CID 61179515) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2S)-N-(3-hydroxy-2,4-dimethylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3-hydroxy-2,4-dimethylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 61179515 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2S)-N-(3-hydroxy-2,4-dimethylphenyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCN2)c(C)c1O |
| InChI | InChI=1S/C13H18N2O2/c1-8-5-6-10(9(2)12(8)16)15-13(17)11-4-3-7-14-11/h5-6,11,14,16H,3-4,7H2,1-2H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | XIFZQGAHHWUGES-NSHDSACASA-N |
| XLogP | 1.70 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |