C15H24N2O2 — CID 106633371
4,5-dimethoxy-2-methyl-N-(piperidin-2-ylmethyl)aniline (PubChem CID 106633371) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4,5-dimethoxy-2-methyl-N-(piperidin-2-ylmethyl)aniline.
| Compound Name | 4,5-dimethoxy-2-methyl-N-(piperidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 106633371 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 4,5-dimethoxy-2-methyl-N-(piperidin-2-ylmethyl)aniline |
| SMILES | COc1cc(C)c(NCC2CCCCN2)cc1OC |
| InChI | InChI=1S/C15H24N2O2/c1-11-8-14(18-2)15(19-3)9-13(11)17-10-12-6-4-5-7-16-12/h8-9,12,16-17H,4-7,10H2,1-3H3 |
| InChIKey | UZQFNOODNSMJAI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|