C15H24N2O2 — CID 116936006
1-(4,5-dimethoxy-2-methylphenyl)-2-pyrrolidin-2-ylethanamine (PubChem CID 116936006) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)-2-pyrrolidin-2-ylethanamine.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)-2-pyrrolidin-2-ylethanamine |
|---|---|
| PubChem CID | 116936006 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)-2-pyrrolidin-2-ylethanamine |
| SMILES | COc1cc(C)c(C(N)CC2CCCN2)cc1OC |
| InChI | InChI=1S/C15H24N2O2/c1-10-7-14(18-2)15(19-3)9-12(10)13(16)8-11-5-4-6-17-11/h7,9,11,13,17H,4-6,8,16H2,1-3H3 |
| InChIKey | JXLJRKOTUIBMBD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |