C25H28N2O4 — CID 66984484
2,4-bis(4-methoxyphenoxy)-N-(pyrrolidin-2-ylmethyl)aniline (PubChem CID 66984484) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenoxy)-N-(pyrrolidin-2-ylmethyl)aniline.
| Compound Name | 2,4-bis(4-methoxyphenoxy)-N-(pyrrolidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 66984484 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2,4-bis(4-methoxyphenoxy)-N-(pyrrolidin-2-ylmethyl)aniline |
| SMILES | COc1ccc(Oc2ccc(NCC3CCCN3)c(Oc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-28-19-5-9-21(10-6-19)30-23-13-14-24(27-17-18-4-3-15-26-18)25(16-23)31-22-11-7-20(29-2)8-12-22/h5-14,16,18,26-27H,3-4,15,17H2,1-2H3 |
| InChIKey | DPZMULVRTYQFKO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |