C24H23N3O — CID 52935661
3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzonitrile (PubChem CID 52935661) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzonitrile.
| Compound Name | 3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 52935661 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2cc(-c3ccccc3)ccc2NC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C24H23N3O/c25-16-18-6-4-10-22(14-18)28-24-15-20(19-7-2-1-3-8-19)11-12-23(24)27-17-21-9-5-13-26-21/h1-4,6-8,10-12,14-15,21,26-27H,5,9,13,17H2/t21-/m0/s1 |
| InChIKey | YBYUBXWNGAWPCG-NRFANRHFSA-N |
| XLogP | 5.18 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |