C29H31N3O3 — CID 66984926
tert-butyl 2-[[2-(4-cyanophenoxy)-4-phenylanilino]methyl]pyrrolidine-1-carboxylate (PubChem CID 66984926) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is tert-butyl 2-[[2-(4-cyanophenoxy)-4-phenylanilino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[2-(4-cyanophenoxy)-4-phenylanilino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66984926 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | tert-butyl 2-[[2-(4-cyanophenoxy)-4-phenylanilino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CNc1ccc(-c2ccccc2)cc1Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-29(2,3)35-28(33)32-17-7-10-24(32)20-31-26-16-13-23(22-8-5-4-6-9-22)18-27(26)34-25-14-11-21(19-30)12-15-25/h4-6,8-9,11-16,18,24,31H,7,10,17,20H2,1-3H3 |
| InChIKey | YWCAXTTVOYYMKE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |