C25H26N2O3 — CID 52935878
methyl 3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzoate (PubChem CID 52935878) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl 3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzoate.
| Compound Name | methyl 3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzoate |
|---|---|
| PubChem CID | 52935878 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | methyl 3-[5-phenyl-2-[[(2S)-pyrrolidin-2-yl]methylamino]phenoxy]benzoate |
| SMILES | COC(=O)c1cccc(Oc2cc(-c3ccccc3)ccc2NC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-29-25(28)20-9-5-11-22(15-20)30-24-16-19(18-7-3-2-4-8-18)12-13-23(24)27-17-21-10-6-14-26-21/h2-5,7-9,11-13,15-16,21,26-27H,6,10,14,17H2,1H3/t21-/m0/s1 |
| InChIKey | FJAPZRRPQOQECH-NRFANRHFSA-N |
| XLogP | 5.10 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |