C26H33N5O4 — CID 58243063
2-[4-(diethylaminooxy)phenoxy]-4-(4-methoxyphenoxy)-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine (PubChem CID 58243063) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[4-(diethylaminooxy)phenoxy]-4-(4-methoxyphenoxy)-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine.
| Compound Name | 2-[4-(diethylaminooxy)phenoxy]-4-(4-methoxyphenoxy)-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 58243063 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 2-[4-(diethylaminooxy)phenoxy]-4-(4-methoxyphenoxy)-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine |
| SMILES | CCN(CC)Oc1ccc(Oc2ncc(NC[C@@H]3CCCN3)c(Oc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C26H33N5O4/c1-4-31(5-2)35-23-14-12-22(13-15-23)34-26-29-18-24(28-17-19-7-6-16-27-19)25(30-26)33-21-10-8-20(32-3)9-11-21/h8-15,18-19,27-28H,4-7,16-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | SNCFZSFTQPNAKR-IBGZPJMESA-N |
| XLogP | 4.87 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|