C21H23N5O2 — CID 52938467
4-(2-methoxyphenoxy)-2-pyridin-3-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine (PubChem CID 52938467) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-(2-methoxyphenoxy)-2-pyridin-3-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine.
| Compound Name | 4-(2-methoxyphenoxy)-2-pyridin-3-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 52938467 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 4-(2-methoxyphenoxy)-2-pyridin-3-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine |
| SMILES | COc1ccccc1Oc1nc(-c2cccnc2)ncc1NC[C@@H]1CCCN1 |
| InChI | InChI=1S/C21H23N5O2/c1-27-18-8-2-3-9-19(18)28-21-17(24-13-16-7-5-11-23-16)14-25-20(26-21)15-6-4-10-22-12-15/h2-4,6,8-10,12,14,16,23-24H,5,7,11,13H2,1H3/t16-/m0/s1 |
| InChIKey | CFIKFNZDVBNIMQ-INIZCTEOSA-N |
| XLogP | 3.50 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |