C26H26N4O2 — CID 52939968
4-(4-methoxyphenoxy)-2-naphthalen-2-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine (PubChem CID 52939968) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-2-naphthalen-2-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine.
| Compound Name | 4-(4-methoxyphenoxy)-2-naphthalen-2-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 52939968 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4-(4-methoxyphenoxy)-2-naphthalen-2-yl-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrimidin-5-amine |
| SMILES | COc1ccc(Oc2nc(-c3ccc4ccccc4c3)ncc2NC[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-31-22-10-12-23(13-11-22)32-26-24(28-16-21-7-4-14-27-21)17-29-25(30-26)20-9-8-18-5-2-3-6-19(18)15-20/h2-3,5-6,8-13,15,17,21,27-28H,4,7,14,16H2,1H3/t21-/m0/s1 |
| InChIKey | MAESGCBZMWLISQ-NRFANRHFSA-N |
| XLogP | 5.26 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |