C9H11ClN2O2 — CID 115028932
6-chloro-4-(propylamino)pyridine-3-carboxylic acid (PubChem CID 115028932) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 6-chloro-4-(propylamino)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-4-(propylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 115028932 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 6-chloro-4-(propylamino)pyridine-3-carboxylic acid |
| SMILES | CCCNc1cc(Cl)ncc1C(=O)O |
| InChI | InChI=1S/C9H11ClN2O2/c1-2-3-11-7-4-8(10)12-5-6(7)9(13)14/h4-5H,2-3H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | ISYBNCURSVPKPE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|