C9H5Cl4N3O4 — CID 174214058
6-chloro-4-[(2,2,2-trichloroacetyl)carbamoylamino]pyridine-3-carboxylic acid (PubChem CID 174214058) has the molecular formula C9H5Cl4N3O4 and a molecular weight of 360.97 g/mol. Its IUPAC name is 6-chloro-4-[(2,2,2-trichloroacetyl)carbamoylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-4-[(2,2,2-trichloroacetyl)carbamoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174214058 |
| Molecular Formula | C9H5Cl4N3O4 |
| Molecular Weight | 360.97 g/mol |
| Exact Mass | 358.90 |
| IUPAC Name | 6-chloro-4-[(2,2,2-trichloroacetyl)carbamoylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(NC(=O)C(Cl)(Cl)Cl)Nc1cc(Cl)ncc1C(=O)O |
| InChI | InChI=1S/C9H5Cl4N3O4/c10-5-1-4(3(2-14-5)6(17)18)15-8(20)16-7(19)9(11,12)13/h1-2H,(H,17,18)(H2,14,15,16,19,20) |
| InChIKey | NLPWALFAMYOUHR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.97 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|