C18H23ClN2O2 — CID 167426727
4-[[[2-chloro-5-[2-(oxolan-2-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol (PubChem CID 167426727) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 4-[[[2-chloro-5-[2-(oxolan-2-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[[2-chloro-5-[2-(oxolan-2-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 167426727 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[[[2-chloro-5-[2-(oxolan-2-yl)ethynyl]-4-pyridinyl]amino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCC(CNc2cc(Cl)ncc2C#CC2CCCO2)CC1 |
| InChI | InChI=1S/C18H23ClN2O2/c19-18-10-17(20-11-13-3-6-15(22)7-4-13)14(12-21-18)5-8-16-2-1-9-23-16/h10,12-13,15-16,22H,1-4,6-7,9,11H2,(H,20,21) |
| InChIKey | BTTCGLGENFSTAM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|