C17H21ClF2N4O — CID 167426166
[4-[[2-chloro-5-[1-(2,2-difluoroethyl)pyrazol-3-yl]-4-pyridinyl]amino]cyclohexyl]methanol (PubChem CID 167426166) has the molecular formula C17H21ClF2N4O and a molecular weight of 370.83 g/mol. Its IUPAC name is [4-[[2-chloro-5-[1-(2,2-difluoroethyl)pyrazol-3-yl]-4-pyridinyl]amino]cyclohexyl]methanol.
| Compound Name | [4-[[2-chloro-5-[1-(2,2-difluoroethyl)pyrazol-3-yl]-4-pyridinyl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 167426166 |
| Molecular Formula | C17H21ClF2N4O |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [4-[[2-chloro-5-[1-(2,2-difluoroethyl)pyrazol-3-yl]-4-pyridinyl]amino]cyclohexyl]methanol |
| SMILES | OCC1CCC(Nc2cc(Cl)ncc2-c2ccn(CC(F)F)n2)CC1 |
| InChI | InChI=1S/C17H21ClF2N4O/c18-16-7-15(22-12-3-1-11(10-25)2-4-12)13(8-21-16)14-5-6-24(23-14)9-17(19)20/h5-8,11-12,17,25H,1-4,9-10H2,(H,21,22) |
| InChIKey | VQZHIPVAMGUABF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|